C26H25NO5 — CID 55404534
[2-[(2-methoxyphenyl)methylamino]-2-oxoethyl] 4-oxo-4-(4-phenylphenyl)butanoate (PubChem CID 55404534) has the molecular formula C26H25NO5 and a molecular weight of 431.49 g/mol. Its IUPAC name is [2-[(2-methoxyphenyl)methylamino]-2-oxoethyl] 4-oxo-4-(4-phenylphenyl)butanoate.
| Compound Name | [2-[(2-methoxyphenyl)methylamino]-2-oxoethyl] 4-oxo-4-(4-phenylphenyl)butanoate |
|---|---|
| PubChem CID | 55404534 |
| Molecular Formula | C26H25NO5 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | [2-[(2-methoxyphenyl)methylamino]-2-oxoethyl] 4-oxo-4-(4-phenylphenyl)butanoate |
| SMILES | COc1ccccc1CNC(=O)COC(=O)CCC(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C26H25NO5/c1-31-24-10-6-5-9-22(24)17-27-25(29)18-32-26(30)16-15-23(28)21-13-11-20(12-14-21)19-7-3-2-4-8-19/h2-14H,15-18H2,1H3,(H,27,29) |
| InChIKey | ORBJACURXDSXSI-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |