C20H24N2O6 — CID 55404779
[1-(4-acetyl-3,5-dimethyl-1H-pyrrol-2-yl)-1-oxopropan-2-yl] 4-(furan-2-carbonylamino)butanoate (PubChem CID 55404779) has the molecular formula C20H24N2O6 and a molecular weight of 388.42 g/mol. Its IUPAC name is [1-(4-acetyl-3,5-dimethyl-1H-pyrrol-2-yl)-1-oxopropan-2-yl] 4-(furan-2-carbonylamino)butanoate.
| Compound Name | [1-(4-acetyl-3,5-dimethyl-1H-pyrrol-2-yl)-1-oxopropan-2-yl] 4-(furan-2-carbonylamino)butanoate |
|---|---|
| PubChem CID | 55404779 |
| Molecular Formula | C20H24N2O6 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | [1-(4-acetyl-3,5-dimethyl-1H-pyrrol-2-yl)-1-oxopropan-2-yl] 4-(furan-2-carbonylamino)butanoate |
| SMILES | CC(=O)c1c(C)[nH]c(C(=O)C(C)OC(=O)CCCNC(=O)c2ccco2)c1C |
| InChI | InChI=1S/C20H24N2O6/c1-11-17(13(3)23)12(2)22-18(11)19(25)14(4)28-16(24)8-5-9-21-20(26)15-7-6-10-27-15/h6-7,10,14,22H,5,8-9H2,1-4H3,(H,21,26) |
| InChIKey | NDBKRLXDKGKRFY-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 118.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|