About methyl 8-hydroxyoctanoate
methyl 8-hydroxyoctanoate (PubChem CID 554055) has the molecular formula C9H18O3
and a molecular weight of 174.24 g/mol. Its IUPAC name is methyl 8-hydroxyoctanoate.
Molecular Properties
| Compound Name | methyl 8-hydroxyoctanoate |
| PubChem CID | 554055 |
| Molecular Formula | C9H18O3 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.13 |
| IUPAC Name | methyl 8-hydroxyoctanoate |
| SMILES | COC(=O)CCCCCCCO |
| InChI | InChI=1S/C9H18O3/c1-12-9(11)7-5-3-2-4-6-8-10/h10H,2-8H2,1H3 |
| InChIKey | ADTIBIOIERBRIB-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 8-hydroxyoctanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 8-hydroxyoctanoate?
The IUPAC name of methyl 8-hydroxyoctanoate (CID 554055) is methyl 8-hydroxyoctanoate.
What is the SMILES notation for methyl 8-hydroxyoctanoate?
The canonical SMILES for methyl 8-hydroxyoctanoate is COC(=O)CCCCCCCO.
What is the InChIKey of methyl 8-hydroxyoctanoate?
The InChIKey is ADTIBIOIERBRIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O3/c1-12-9(11)7-5-3-2-4-6-8-10/h10H,2-8H2,1H3.
What are the key properties of methyl 8-hydroxyoctanoate?
methyl 8-hydroxyoctanoate has a molecular weight of 174.24 g/mol, XLogP of 1.49, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 8-hydroxyoctanoate is sourced from PubChem (CID 554055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).