About 4,4,5-trimethyl-6,8-dioxa-3-thiabicyclo[3.2.1]octane
4,4,5-trimethyl-6,8-dioxa-3-thiabicyclo[3.2.1]octane (PubChem CID 554057) has the molecular formula C8H14O2S
and a molecular weight of 174.26 g/mol. Its IUPAC name is 4,4,5-trimethyl-6,8-dioxa-3-thiabicyclo[3.2.1]octane.
Molecular Properties
| Compound Name | 4,4,5-trimethyl-6,8-dioxa-3-thiabicyclo[3.2.1]octane |
| PubChem CID | 554057 |
| Molecular Formula | C8H14O2S |
| Molecular Weight | 174.26 g/mol |
| Exact Mass | 174.07 |
| IUPAC Name | 4,4,5-trimethyl-6,8-dioxa-3-thiabicyclo[3.2.1]octane |
| SMILES | CC12OCC(CSC1(C)C)O2 |
| InChI | InChI=1S/C8H14O2S/c1-7(2)8(3)9-4-6(10-8)5-11-7/h6H,4-5H2,1-3H3 |
| InChIKey | GVUDOWQPVVUZDI-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.26 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,4,5-trimethyl-6,8-dioxa-3-thiabicyclo[3.2.1]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4,5-trimethyl-6,8-dioxa-3-thiabicyclo[3.2.1]octane?
The IUPAC name of 4,4,5-trimethyl-6,8-dioxa-3-thiabicyclo[3.2.1]octane (CID 554057) is 4,4,5-trimethyl-6,8-dioxa-3-thiabicyclo[3.2.1]octane.
What is the SMILES notation for 4,4,5-trimethyl-6,8-dioxa-3-thiabicyclo[3.2.1]octane?
The canonical SMILES for 4,4,5-trimethyl-6,8-dioxa-3-thiabicyclo[3.2.1]octane is CC12OCC(CSC1(C)C)O2.
What is the InChIKey of 4,4,5-trimethyl-6,8-dioxa-3-thiabicyclo[3.2.1]octane?
The InChIKey is GVUDOWQPVVUZDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O2S/c1-7(2)8(3)9-4-6(10-8)5-11-7/h6H,4-5H2,1-3H3.
What are the key properties of 4,4,5-trimethyl-6,8-dioxa-3-thiabicyclo[3.2.1]octane?
4,4,5-trimethyl-6,8-dioxa-3-thiabicyclo[3.2.1]octane has a molecular weight of 174.26 g/mol, XLogP of 1.64, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4,5-trimethyl-6,8-dioxa-3-thiabicyclo[3.2.1]octane is sourced from PubChem (CID 554057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).