C19H21N3O4 — CID 55407334
2,5-dimethyl-N'-[3-[(2-oxopyrrolidin-1-yl)methyl]benzoyl]furan-3-carbohydrazide (PubChem CID 55407334) has the molecular formula C19H21N3O4 and a molecular weight of 355.39 g/mol. Its IUPAC name is 2,5-dimethyl-N'-[3-[(2-oxopyrrolidin-1-yl)methyl]benzoyl]furan-3-carbohydrazide.
| Compound Name | 2,5-dimethyl-N'-[3-[(2-oxopyrrolidin-1-yl)methyl]benzoyl]furan-3-carbohydrazide |
|---|---|
| PubChem CID | 55407334 |
| Molecular Formula | C19H21N3O4 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 2,5-dimethyl-N'-[3-[(2-oxopyrrolidin-1-yl)methyl]benzoyl]furan-3-carbohydrazide |
| SMILES | Cc1cc(C(=O)NNC(=O)c2cccc(CN3CCCC3=O)c2)c(C)o1 |
| InChI | InChI=1S/C19H21N3O4/c1-12-9-16(13(2)26-12)19(25)21-20-18(24)15-6-3-5-14(10-15)11-22-8-4-7-17(22)23/h3,5-6,9-10H,4,7-8,11H2,1-2H3,(H,20,24)(H,21,25) |
| InChIKey | BKJUYHDURRFIIU-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|