C27H33ClN2O4 — CID 55407568
azepan-1-yl-[1-[4-[(4-chlorophenyl)methoxy]-3-methoxybenzoyl]piperidin-4-yl]methanone (PubChem CID 55407568) has the molecular formula C27H33ClN2O4 and a molecular weight of 485.02 g/mol. Its IUPAC name is azepan-1-yl-[1-[4-[(4-chlorophenyl)methoxy]-3-methoxybenzoyl]piperidin-4-yl]methanone.
| Compound Name | azepan-1-yl-[1-[4-[(4-chlorophenyl)methoxy]-3-methoxybenzoyl]piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 55407568 |
| Molecular Formula | C27H33ClN2O4 |
| Molecular Weight | 485.02 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | azepan-1-yl-[1-[4-[(4-chlorophenyl)methoxy]-3-methoxybenzoyl]piperidin-4-yl]methanone |
| SMILES | COc1cc(C(=O)N2CCC(C(=O)N3CCCCCC3)CC2)ccc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H33ClN2O4/c1-33-25-18-22(8-11-24(25)34-19-20-6-9-23(28)10-7-20)27(32)30-16-12-21(13-17-30)26(31)29-14-4-2-3-5-15-29/h6-11,18,21H,2-5,12-17,19H2,1H3 |
| InChIKey | BBWLOUVNNIHMFY-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.02 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |