C20H25N3O5S — CID 55408224
3-(dimethylsulfamoyl)-N,4,5-trimethyl-N-[1-(3-nitrophenyl)ethyl]benzamide (PubChem CID 55408224) has the molecular formula C20H25N3O5S and a molecular weight of 419.50 g/mol. Its IUPAC name is 3-(dimethylsulfamoyl)-N,4,5-trimethyl-N-[1-(3-nitrophenyl)ethyl]benzamide.
| Compound Name | 3-(dimethylsulfamoyl)-N,4,5-trimethyl-N-[1-(3-nitrophenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 55408224 |
| Molecular Formula | C20H25N3O5S |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | 3-(dimethylsulfamoyl)-N,4,5-trimethyl-N-[1-(3-nitrophenyl)ethyl]benzamide |
| SMILES | Cc1cc(C(=O)N(C)C(C)c2cccc([N+](=O)[O-])c2)cc(S(=O)(=O)N(C)C)c1C |
| InChI | InChI=1S/C20H25N3O5S/c1-13-10-17(12-19(14(13)2)29(27,28)21(4)5)20(24)22(6)15(3)16-8-7-9-18(11-16)23(25)26/h7-12,15H,1-6H3 |
| InChIKey | HUUGUXAUVMFXOY-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|