C23H24N4O3 — CID 55408620
N'-[1-(2-ethylphenyl)-5-oxopyrrolidine-3-carbonyl]-1-methylindole-3-carbohydrazide (PubChem CID 55408620) has the molecular formula C23H24N4O3 and a molecular weight of 404.47 g/mol. Its IUPAC name is N'-[1-(2-ethylphenyl)-5-oxopyrrolidine-3-carbonyl]-1-methylindole-3-carbohydrazide.
| Compound Name | N'-[1-(2-ethylphenyl)-5-oxopyrrolidine-3-carbonyl]-1-methylindole-3-carbohydrazide |
|---|---|
| PubChem CID | 55408620 |
| Molecular Formula | C23H24N4O3 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | N'-[1-(2-ethylphenyl)-5-oxopyrrolidine-3-carbonyl]-1-methylindole-3-carbohydrazide |
| SMILES | CCc1ccccc1N1CC(C(=O)NNC(=O)c2cn(C)c3ccccc23)CC1=O |
| InChI | InChI=1S/C23H24N4O3/c1-3-15-8-4-6-10-19(15)27-13-16(12-21(27)28)22(29)24-25-23(30)18-14-26(2)20-11-7-5-9-17(18)20/h4-11,14,16H,3,12-13H2,1-2H3,(H,24,29)(H,25,30) |
| InChIKey | XRYJYKDIYKWJRB-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 83.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|