C23H34N4O3 — CID 55412944
2-[4-(2-morpholin-4-yl-2-oxoethyl)piperazin-1-yl]-2-phenyl-1-piperidin-1-ylethanone (PubChem CID 55412944) has the molecular formula C23H34N4O3 and a molecular weight of 414.55 g/mol. Its IUPAC name is 2-[4-(2-morpholin-4-yl-2-oxoethyl)piperazin-1-yl]-2-phenyl-1-piperidin-1-ylethanone.
| Compound Name | 2-[4-(2-morpholin-4-yl-2-oxoethyl)piperazin-1-yl]-2-phenyl-1-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 55412944 |
| Molecular Formula | C23H34N4O3 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.26 |
| IUPAC Name | 2-[4-(2-morpholin-4-yl-2-oxoethyl)piperazin-1-yl]-2-phenyl-1-piperidin-1-ylethanone |
| SMILES | O=C(CN1CCN(C(C(=O)N2CCCCC2)c2ccccc2)CC1)N1CCOCC1 |
| InChI | InChI=1S/C23H34N4O3/c28-21(25-15-17-30-18-16-25)19-24-11-13-26(14-12-24)22(20-7-3-1-4-8-20)23(29)27-9-5-2-6-10-27/h1,3-4,7-8,22H,2,5-6,9-19H2 |
| InChIKey | CBBBSHNFVQDIPD-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 56.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |