C17H31N5O4 — CID 55412983
N-(butylcarbamoyl)-2-[4-(2-morpholin-4-yl-2-oxoethyl)piperazin-1-yl]acetamide (PubChem CID 55412983) has the molecular formula C17H31N5O4 and a molecular weight of 369.47 g/mol. Its IUPAC name is N-(butylcarbamoyl)-2-[4-(2-morpholin-4-yl-2-oxoethyl)piperazin-1-yl]acetamide.
| Compound Name | N-(butylcarbamoyl)-2-[4-(2-morpholin-4-yl-2-oxoethyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 55412983 |
| Molecular Formula | C17H31N5O4 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.24 |
| IUPAC Name | N-(butylcarbamoyl)-2-[4-(2-morpholin-4-yl-2-oxoethyl)piperazin-1-yl]acetamide |
| SMILES | CCCCNC(=O)NC(=O)CN1CCN(CC(=O)N2CCOCC2)CC1 |
| InChI | InChI=1S/C17H31N5O4/c1-2-3-4-18-17(25)19-15(23)13-20-5-7-21(8-6-20)14-16(24)22-9-11-26-12-10-22/h2-14H2,1H3,(H2,18,19,23,25) |
| InChIKey | PLFFXKJGHGJIPE-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|