C20H16FN3O4S2 — CID 55413155
methyl 3-[[(E)-3-[2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]prop-2-enoyl]amino]thiophene-2-carboxylate (PubChem CID 55413155) has the molecular formula C20H16FN3O4S2 and a molecular weight of 445.50 g/mol. Its IUPAC name is methyl 3-[[(E)-3-[2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]prop-2-enoyl]amino]thiophene-2-carboxylate.
| Compound Name | methyl 3-[[(E)-3-[2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]prop-2-enoyl]amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 55413155 |
| Molecular Formula | C20H16FN3O4S2 |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.06 |
| IUPAC Name | methyl 3-[[(E)-3-[2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]prop-2-enoyl]amino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1NC(=O)/C=C/c1csc(N(C(C)=O)c2ccccc2F)n1 |
| InChI | InChI=1S/C20H16FN3O4S2/c1-12(25)24(16-6-4-3-5-14(16)21)20-22-13(11-30-20)7-8-17(26)23-15-9-10-29-18(15)19(27)28-2/h3-11H,1-2H3,(H,23,26)/b8-7+ |
| InChIKey | FLORITDHVPOKBO-BQYQJAHWSA-N |
| XLogP | 4.47 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|