C27H26N2O5 — CID 55413954
[4-[(2-methoxybenzoyl)amino]phenyl] 2-(2-acetyl-3,4-dihydro-1H-isoquinolin-1-yl)acetate (PubChem CID 55413954) has the molecular formula C27H26N2O5 and a molecular weight of 458.51 g/mol. Its IUPAC name is [4-[(2-methoxybenzoyl)amino]phenyl] 2-(2-acetyl-3,4-dihydro-1H-isoquinolin-1-yl)acetate.
| Compound Name | [4-[(2-methoxybenzoyl)amino]phenyl] 2-(2-acetyl-3,4-dihydro-1H-isoquinolin-1-yl)acetate |
|---|---|
| PubChem CID | 55413954 |
| Molecular Formula | C27H26N2O5 |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | [4-[(2-methoxybenzoyl)amino]phenyl] 2-(2-acetyl-3,4-dihydro-1H-isoquinolin-1-yl)acetate |
| SMILES | COc1ccccc1C(=O)Nc1ccc(OC(=O)CC2c3ccccc3CCN2C(C)=O)cc1 |
| InChI | InChI=1S/C27H26N2O5/c1-18(30)29-16-15-19-7-3-4-8-22(19)24(29)17-26(31)34-21-13-11-20(12-14-21)28-27(32)23-9-5-6-10-25(23)33-2/h3-14,24H,15-17H2,1-2H3,(H,28,32) |
| InChIKey | PUDVFVGTSIRLIQ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|