C20H18F3N3O3S — CID 55414156
2-(3,4-dimethoxyphenyl)-4-methyl-N'-[2-(trifluoromethyl)phenyl]-1,3-thiazole-5-carbohydrazide (PubChem CID 55414156) has the molecular formula C20H18F3N3O3S and a molecular weight of 437.44 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-4-methyl-N'-[2-(trifluoromethyl)phenyl]-1,3-thiazole-5-carbohydrazide.
| Compound Name | 2-(3,4-dimethoxyphenyl)-4-methyl-N'-[2-(trifluoromethyl)phenyl]-1,3-thiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 55414156 |
| Molecular Formula | C20H18F3N3O3S |
| Molecular Weight | 437.44 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-4-methyl-N'-[2-(trifluoromethyl)phenyl]-1,3-thiazole-5-carbohydrazide |
| SMILES | COc1ccc(-c2nc(C)c(C(=O)NNc3ccccc3C(F)(F)F)s2)cc1OC |
| InChI | InChI=1S/C20H18F3N3O3S/c1-11-17(18(27)26-25-14-7-5-4-6-13(14)20(21,22)23)30-19(24-11)12-8-9-15(28-2)16(10-12)29-3/h4-10,25H,1-3H3,(H,26,27) |
| InChIKey | GKXZGEMRLHAVBF-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.44 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|