About ethyl 2-[[5-(benzenesulfonylmethyl)furan-2-carbonyl]amino]-4-phenyl-1,3-thiazole-5-carboxylate
ethyl 2-[[5-(benzenesulfonylmethyl)furan-2-carbonyl]amino]-4-phenyl-1,3-thiazole-5-carboxylate (PubChem CID 55414723) has the molecular formula C24H20N2O6S2
and a molecular weight of 496.57 g/mol. Its IUPAC name is ethyl 2-[[5-(benzenesulfonylmethyl)furan-2-carbonyl]amino]-4-phenyl-1,3-thiazole-5-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-[[5-(benzenesulfonylmethyl)furan-2-carbonyl]amino]-4-phenyl-1,3-thiazole-5-carboxylate |
| PubChem CID | 55414723 |
| Molecular Formula | C24H20N2O6S2 |
| Molecular Weight | 496.57 g/mol |
| Exact Mass | 496.08 |
| IUPAC Name | ethyl 2-[[5-(benzenesulfonylmethyl)furan-2-carbonyl]amino]-4-phenyl-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(NC(=O)c2ccc(CS(=O)(=O)c3ccccc3)o2)nc1-c1ccccc1 |
| InChI | InChI=1S/C24H20N2O6S2/c1-2-31-23(28)21-20(16-9-5-3-6-10-16)25-24(33-21)26-22(27)19-14-13-17(32-19)15-34(29,30)18-11-7-4-8-12-18/h3-14H,2,15H2,1H3,(H,25,26,27) |
| InChIKey | NOADQLTYOSEBEI-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 115.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 496.57 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze ethyl 2-[[5-(benzenesulfonylmethyl)furan-2-carbonyl]amino]-4-phenyl-1,3-thiazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[[5-(benzenesulfonylmethyl)furan-2-carbonyl]amino]-4-phenyl-1,3-thiazole-5-carboxylate?
The IUPAC name of ethyl 2-[[5-(benzenesulfonylmethyl)furan-2-carbonyl]amino]-4-phenyl-1,3-thiazole-5-carboxylate (CID 55414723) is ethyl 2-[[5-(benzenesulfonylmethyl)furan-2-carbonyl]amino]-4-phenyl-1,3-thiazole-5-carboxylate.
What is the SMILES notation for ethyl 2-[[5-(benzenesulfonylmethyl)furan-2-carbonyl]amino]-4-phenyl-1,3-thiazole-5-carboxylate?
The canonical SMILES for ethyl 2-[[5-(benzenesulfonylmethyl)furan-2-carbonyl]amino]-4-phenyl-1,3-thiazole-5-carboxylate is CCOC(=O)c1sc(NC(=O)c2ccc(CS(=O)(=O)c3ccccc3)o2)nc1-c1ccccc1.
What is the InChIKey of ethyl 2-[[5-(benzenesulfonylmethyl)furan-2-carbonyl]amino]-4-phenyl-1,3-thiazole-5-carboxylate?
The InChIKey is NOADQLTYOSEBEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20N2O6S2/c1-2-31-23(28)21-20(16-9-5-3-6-10-16)25-24(33-21)26-22(27)19-14-13-17(32-19)15-34(29,30)18-11-7-4-8-12-18/h3-14H,2,15H2,1H3,(H,25,26,27).
What are the key properties of ethyl 2-[[5-(benzenesulfonylmethyl)furan-2-carbonyl]amino]-4-phenyl-1,3-thiazole-5-carboxylate?
ethyl 2-[[5-(benzenesulfonylmethyl)furan-2-carbonyl]amino]-4-phenyl-1,3-thiazole-5-carboxylate has a molecular weight of 496.57 g/mol, XLogP of 4.81, 8 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[[5-(benzenesulfonylmethyl)furan-2-carbonyl]amino]-4-phenyl-1,3-thiazole-5-carboxylate is sourced from PubChem (CID 55414723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).