C22H25N3O9 — CID 55415375
N-[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl]-N-ethyl-3,4,5-trimethoxy-2-nitrobenzamide (PubChem CID 55415375) has the molecular formula C22H25N3O9 and a molecular weight of 475.45 g/mol. Its IUPAC name is N-[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl]-N-ethyl-3,4,5-trimethoxy-2-nitrobenzamide.
| Compound Name | N-[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl]-N-ethyl-3,4,5-trimethoxy-2-nitrobenzamide |
|---|---|
| PubChem CID | 55415375 |
| Molecular Formula | C22H25N3O9 |
| Molecular Weight | 475.45 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | N-[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl]-N-ethyl-3,4,5-trimethoxy-2-nitrobenzamide |
| SMILES | CCN(CC(=O)Nc1ccc2c(c1)OCCO2)C(=O)c1cc(OC)c(OC)c(OC)c1[N+](=O)[O-] |
| InChI | InChI=1S/C22H25N3O9/c1-5-24(12-18(26)23-13-6-7-15-16(10-13)34-9-8-33-15)22(27)14-11-17(30-2)20(31-3)21(32-4)19(14)25(28)29/h6-7,10-11H,5,8-9,12H2,1-4H3,(H,23,26) |
| InChIKey | QEKTZIRRIGSYHM-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 138.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.45 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|