C21H26N2O4 — CID 55417663
[1-(4-methoxyanilino)-1-oxopropan-2-yl] 4-(diethylamino)benzoate (PubChem CID 55417663) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is [1-(4-methoxyanilino)-1-oxopropan-2-yl] 4-(diethylamino)benzoate.
| Compound Name | [1-(4-methoxyanilino)-1-oxopropan-2-yl] 4-(diethylamino)benzoate |
|---|---|
| PubChem CID | 55417663 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | [1-(4-methoxyanilino)-1-oxopropan-2-yl] 4-(diethylamino)benzoate |
| SMILES | CCN(CC)c1ccc(C(=O)OC(C)C(=O)Nc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C21H26N2O4/c1-5-23(6-2)18-11-7-16(8-12-18)21(25)27-15(3)20(24)22-17-9-13-19(26-4)14-10-17/h7-15H,5-6H2,1-4H3,(H,22,24) |
| InChIKey | IXHAYGRARIANGA-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |