C17H15ClINO3 — CID 55417735
[1-[(2-chlorophenyl)methylamino]-1-oxopropan-2-yl] 4-iodobenzoate (PubChem CID 55417735) has the molecular formula C17H15ClINO3 and a molecular weight of 443.67 g/mol. Its IUPAC name is [1-[(2-chlorophenyl)methylamino]-1-oxopropan-2-yl] 4-iodobenzoate.
| Compound Name | [1-[(2-chlorophenyl)methylamino]-1-oxopropan-2-yl] 4-iodobenzoate |
|---|---|
| PubChem CID | 55417735 |
| Molecular Formula | C17H15ClINO3 |
| Molecular Weight | 443.67 g/mol |
| Exact Mass | 442.98 |
| IUPAC Name | [1-[(2-chlorophenyl)methylamino]-1-oxopropan-2-yl] 4-iodobenzoate |
| SMILES | CC(OC(=O)c1ccc(I)cc1)C(=O)NCc1ccccc1Cl |
| InChI | InChI=1S/C17H15ClINO3/c1-11(23-17(22)12-6-8-14(19)9-7-12)16(21)20-10-13-4-2-3-5-15(13)18/h2-9,11H,10H2,1H3,(H,20,21) |
| InChIKey | RGVXJQZKFQLASD-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.67 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|