C17H14Cl2FNO4 — CID 55417769
[1-(3-fluoroanilino)-1-oxopropan-2-yl] 2-(2,4-dichlorophenoxy)acetate (PubChem CID 55417769) has the molecular formula C17H14Cl2FNO4 and a molecular weight of 386.21 g/mol. Its IUPAC name is [1-(3-fluoroanilino)-1-oxopropan-2-yl] 2-(2,4-dichlorophenoxy)acetate.
| Compound Name | [1-(3-fluoroanilino)-1-oxopropan-2-yl] 2-(2,4-dichlorophenoxy)acetate |
|---|---|
| PubChem CID | 55417769 |
| Molecular Formula | C17H14Cl2FNO4 |
| Molecular Weight | 386.21 g/mol |
| Exact Mass | 385.03 |
| IUPAC Name | [1-(3-fluoroanilino)-1-oxopropan-2-yl] 2-(2,4-dichlorophenoxy)acetate |
| SMILES | CC(OC(=O)COc1ccc(Cl)cc1Cl)C(=O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C17H14Cl2FNO4/c1-10(17(23)21-13-4-2-3-12(20)8-13)25-16(22)9-24-15-6-5-11(18)7-14(15)19/h2-8,10H,9H2,1H3,(H,21,23) |
| InChIKey | BBIQANBGYJCMFO-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.21 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |