C14H14F6N4O8 — CID 55417915
bis[2-oxo-2-(2,2,2-trifluoroethylcarbamoylamino)ethyl] (E)-but-2-enedioate (PubChem CID 55417915) has the molecular formula C14H14F6N4O8 and a molecular weight of 480.27 g/mol. Its IUPAC name is bis[2-oxo-2-(2,2,2-trifluoroethylcarbamoylamino)ethyl] (E)-but-2-enedioate.
| Compound Name | bis[2-oxo-2-(2,2,2-trifluoroethylcarbamoylamino)ethyl] (E)-but-2-enedioate |
|---|---|
| PubChem CID | 55417915 |
| Molecular Formula | C14H14F6N4O8 |
| Molecular Weight | 480.27 g/mol |
| Exact Mass | 480.07 |
| IUPAC Name | bis[2-oxo-2-(2,2,2-trifluoroethylcarbamoylamino)ethyl] (E)-but-2-enedioate |
| SMILES | O=C(COC(=O)/C=C/C(=O)OCC(=O)NC(=O)NCC(F)(F)F)NC(=O)NCC(F)(F)F |
| InChI | InChI=1S/C14H14F6N4O8/c15-13(16,17)5-21-11(29)23-7(25)3-31-9(27)1-2-10(28)32-4-8(26)24-12(30)22-6-14(18,19)20/h1-2H,3-6H2,(H2,21,23,25,29)(H2,22,24,26,30)/b2-1+ |
| InChIKey | NHCBXYSZNVBKLK-OWOJBTEDSA-N |
| XLogP | -0.59 |
| TPSA | 169.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.27 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|