C25H21F2NO4 — CID 55418905
[1-(2,4-difluoroanilino)-1-oxopropan-2-yl] (E)-3-(2-methoxyphenyl)-2-phenylprop-2-enoate (PubChem CID 55418905) has the molecular formula C25H21F2NO4 and a molecular weight of 437.44 g/mol. Its IUPAC name is [1-(2,4-difluoroanilino)-1-oxopropan-2-yl] (E)-3-(2-methoxyphenyl)-2-phenylprop-2-enoate.
| Compound Name | [1-(2,4-difluoroanilino)-1-oxopropan-2-yl] (E)-3-(2-methoxyphenyl)-2-phenylprop-2-enoate |
|---|---|
| PubChem CID | 55418905 |
| Molecular Formula | C25H21F2NO4 |
| Molecular Weight | 437.44 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | [1-(2,4-difluoroanilino)-1-oxopropan-2-yl] (E)-3-(2-methoxyphenyl)-2-phenylprop-2-enoate |
| SMILES | COc1ccccc1/C=C(/C(=O)OC(C)C(=O)Nc1ccc(F)cc1F)c1ccccc1 |
| InChI | InChI=1S/C25H21F2NO4/c1-16(24(29)28-22-13-12-19(26)15-21(22)27)32-25(30)20(17-8-4-3-5-9-17)14-18-10-6-7-11-23(18)31-2/h3-16H,1-2H3,(H,28,29)/b20-14+ |
| InChIKey | HTSHBVAWFHQGAT-XSFVSMFZSA-N |
| XLogP | 5.08 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.44 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|