C12H9ClF2N2O4S — CID 55419939
(5-chlorothiadiazol-4-yl)methyl 2-(difluoromethoxy)-3-methoxybenzoate (PubChem CID 55419939) has the molecular formula C12H9ClF2N2O4S and a molecular weight of 350.73 g/mol. Its IUPAC name is (5-chlorothiadiazol-4-yl)methyl 2-(difluoromethoxy)-3-methoxybenzoate.
| Compound Name | (5-chlorothiadiazol-4-yl)methyl 2-(difluoromethoxy)-3-methoxybenzoate |
|---|---|
| PubChem CID | 55419939 |
| Molecular Formula | C12H9ClF2N2O4S |
| Molecular Weight | 350.73 g/mol |
| Exact Mass | 349.99 |
| IUPAC Name | (5-chlorothiadiazol-4-yl)methyl 2-(difluoromethoxy)-3-methoxybenzoate |
| SMILES | COc1cccc(C(=O)OCc2nnsc2Cl)c1OC(F)F |
| InChI | InChI=1S/C12H9ClF2N2O4S/c1-19-8-4-2-3-6(9(8)21-12(14)15)11(18)20-5-7-10(13)22-17-16-7/h2-4,12H,5H2,1H3 |
| InChIKey | VFUNJUKSGUINJH-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.73 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |