C20H20N2O4 — CID 55420830
[1-[2-(4-methoxyphenyl)ethylamino]-1-oxopropan-2-yl] 3-cyanobenzoate (PubChem CID 55420830) has the molecular formula C20H20N2O4 and a molecular weight of 352.39 g/mol. Its IUPAC name is [1-[2-(4-methoxyphenyl)ethylamino]-1-oxopropan-2-yl] 3-cyanobenzoate.
| Compound Name | [1-[2-(4-methoxyphenyl)ethylamino]-1-oxopropan-2-yl] 3-cyanobenzoate |
|---|---|
| PubChem CID | 55420830 |
| Molecular Formula | C20H20N2O4 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | [1-[2-(4-methoxyphenyl)ethylamino]-1-oxopropan-2-yl] 3-cyanobenzoate |
| SMILES | COc1ccc(CCNC(=O)C(C)OC(=O)c2cccc(C#N)c2)cc1 |
| InChI | InChI=1S/C20H20N2O4/c1-14(26-20(24)17-5-3-4-16(12-17)13-21)19(23)22-11-10-15-6-8-18(25-2)9-7-15/h3-9,12,14H,10-11H2,1-2H3,(H,22,23) |
| InChIKey | COSMAHHVYQGDFM-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |