C14H16F3N5O5 — CID 55421440
N-(2,2,2-trifluoroethylcarbamoyl)-2-[2,4,6-trioxo-3,5-bis(prop-2-enyl)-1,3,5-triazinan-1-yl]acetamide (PubChem CID 55421440) has the molecular formula C14H16F3N5O5 and a molecular weight of 391.31 g/mol. Its IUPAC name is N-(2,2,2-trifluoroethylcarbamoyl)-2-[2,4,6-trioxo-3,5-bis(prop-2-enyl)-1,3,5-triazinan-1-yl]acetamide.
| Compound Name | N-(2,2,2-trifluoroethylcarbamoyl)-2-[2,4,6-trioxo-3,5-bis(prop-2-enyl)-1,3,5-triazinan-1-yl]acetamide |
|---|---|
| PubChem CID | 55421440 |
| Molecular Formula | C14H16F3N5O5 |
| Molecular Weight | 391.31 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | N-(2,2,2-trifluoroethylcarbamoyl)-2-[2,4,6-trioxo-3,5-bis(prop-2-enyl)-1,3,5-triazinan-1-yl]acetamide |
| SMILES | C=CCn1c(=O)n(CC=C)c(=O)n(CC(=O)NC(=O)NCC(F)(F)F)c1=O |
| InChI | InChI=1S/C14H16F3N5O5/c1-3-5-20-11(25)21(6-4-2)13(27)22(12(20)26)7-9(23)19-10(24)18-8-14(15,16)17/h3-4H,1-2,5-8H2,(H2,18,19,23,24) |
| InChIKey | DHLZRDAGHXGZQT-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 124.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.31 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|