C17H18N4O6 — CID 55422457
[1-[(5-methyl-1,2-oxazol-3-yl)amino]-1-oxopropan-2-yl] 4-(cyclopropylamino)-3-nitrobenzoate (PubChem CID 55422457) has the molecular formula C17H18N4O6 and a molecular weight of 374.35 g/mol. Its IUPAC name is [1-[(5-methyl-1,2-oxazol-3-yl)amino]-1-oxopropan-2-yl] 4-(cyclopropylamino)-3-nitrobenzoate.
| Compound Name | [1-[(5-methyl-1,2-oxazol-3-yl)amino]-1-oxopropan-2-yl] 4-(cyclopropylamino)-3-nitrobenzoate |
|---|---|
| PubChem CID | 55422457 |
| Molecular Formula | C17H18N4O6 |
| Molecular Weight | 374.35 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | [1-[(5-methyl-1,2-oxazol-3-yl)amino]-1-oxopropan-2-yl] 4-(cyclopropylamino)-3-nitrobenzoate |
| SMILES | Cc1cc(NC(=O)C(C)OC(=O)c2ccc(NC3CC3)c([N+](=O)[O-])c2)no1 |
| InChI | InChI=1S/C17H18N4O6/c1-9-7-15(20-27-9)19-16(22)10(2)26-17(23)11-3-6-13(18-12-4-5-12)14(8-11)21(24)25/h3,6-8,10,12,18H,4-5H2,1-2H3,(H,19,20,22) |
| InChIKey | GHTNRPATQRCARB-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 136.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.35 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|