C20H19FN4O2S — CID 55423602
N-(benzylcarbamoyl)-2-[1-(3-fluorophenyl)imidazol-2-yl]sulfanylpropanamide (PubChem CID 55423602) has the molecular formula C20H19FN4O2S and a molecular weight of 398.46 g/mol. Its IUPAC name is N-(benzylcarbamoyl)-2-[1-(3-fluorophenyl)imidazol-2-yl]sulfanylpropanamide.
| Compound Name | N-(benzylcarbamoyl)-2-[1-(3-fluorophenyl)imidazol-2-yl]sulfanylpropanamide |
|---|---|
| PubChem CID | 55423602 |
| Molecular Formula | C20H19FN4O2S |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | N-(benzylcarbamoyl)-2-[1-(3-fluorophenyl)imidazol-2-yl]sulfanylpropanamide |
| SMILES | CC(Sc1nccn1-c1cccc(F)c1)C(=O)NC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C20H19FN4O2S/c1-14(18(26)24-19(27)23-13-15-6-3-2-4-7-15)28-20-22-10-11-25(20)17-9-5-8-16(21)12-17/h2-12,14H,13H2,1H3,(H2,23,24,26,27) |
| InChIKey | FHNQIRJDMZPGPH-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |