About [1-(2,4-difluoroanilino)-1-oxopropan-2-yl] quinoxaline-2-carboxylate
[1-(2,4-difluoroanilino)-1-oxopropan-2-yl] quinoxaline-2-carboxylate (PubChem CID 55423821) has the molecular formula C18H13F2N3O3
and a molecular weight of 357.32 g/mol. Its IUPAC name is [1-(2,4-difluoroanilino)-1-oxopropan-2-yl] quinoxaline-2-carboxylate.
Molecular Properties
| Compound Name | [1-(2,4-difluoroanilino)-1-oxopropan-2-yl] quinoxaline-2-carboxylate |
| PubChem CID | 55423821 |
| Molecular Formula | C18H13F2N3O3 |
| Molecular Weight | 357.32 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | [1-(2,4-difluoroanilino)-1-oxopropan-2-yl] quinoxaline-2-carboxylate |
| SMILES | CC(OC(=O)c1cnc2ccccc2n1)C(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C18H13F2N3O3/c1-10(17(24)23-13-7-6-11(19)8-12(13)20)26-18(25)16-9-21-14-4-2-3-5-15(14)22-16/h2-10H,1H3,(H,23,24) |
| InChIKey | UGWJIHXQGAIVHZ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.32 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-(2,4-difluoroanilino)-1-oxopropan-2-yl] quinoxaline-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2,4-difluoroanilino)-1-oxopropan-2-yl] quinoxaline-2-carboxylate?
The IUPAC name of [1-(2,4-difluoroanilino)-1-oxopropan-2-yl] quinoxaline-2-carboxylate (CID 55423821) is [1-(2,4-difluoroanilino)-1-oxopropan-2-yl] quinoxaline-2-carboxylate.
What is the SMILES notation for [1-(2,4-difluoroanilino)-1-oxopropan-2-yl] quinoxaline-2-carboxylate?
The canonical SMILES for [1-(2,4-difluoroanilino)-1-oxopropan-2-yl] quinoxaline-2-carboxylate is CC(OC(=O)c1cnc2ccccc2n1)C(=O)Nc1ccc(F)cc1F.
What is the InChIKey of [1-(2,4-difluoroanilino)-1-oxopropan-2-yl] quinoxaline-2-carboxylate?
The InChIKey is UGWJIHXQGAIVHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13F2N3O3/c1-10(17(24)23-13-7-6-11(19)8-12(13)20)26-18(25)16-9-21-14-4-2-3-5-15(14)22-16/h2-10H,1H3,(H,23,24).
What are the key properties of [1-(2,4-difluoroanilino)-1-oxopropan-2-yl] quinoxaline-2-carboxylate?
[1-(2,4-difluoroanilino)-1-oxopropan-2-yl] quinoxaline-2-carboxylate has a molecular weight of 357.32 g/mol, XLogP of 3.09, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2,4-difluoroanilino)-1-oxopropan-2-yl] quinoxaline-2-carboxylate is sourced from PubChem (CID 55423821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).