C25H27N3O4 — CID 55424414
(2-oxo-1-phenyl-2-piperidin-1-ylethyl) 3-(3-methyl-4-oxoquinazolin-2-yl)propanoate (PubChem CID 55424414) has the molecular formula C25H27N3O4 and a molecular weight of 433.51 g/mol. Its IUPAC name is (2-oxo-1-phenyl-2-piperidin-1-ylethyl) 3-(3-methyl-4-oxoquinazolin-2-yl)propanoate.
| Compound Name | (2-oxo-1-phenyl-2-piperidin-1-ylethyl) 3-(3-methyl-4-oxoquinazolin-2-yl)propanoate |
|---|---|
| PubChem CID | 55424414 |
| Molecular Formula | C25H27N3O4 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | (2-oxo-1-phenyl-2-piperidin-1-ylethyl) 3-(3-methyl-4-oxoquinazolin-2-yl)propanoate |
| SMILES | Cn1c(CCC(=O)OC(C(=O)N2CCCCC2)c2ccccc2)nc2ccccc2c1=O |
| InChI | InChI=1S/C25H27N3O4/c1-27-21(26-20-13-7-6-12-19(20)24(27)30)14-15-22(29)32-23(18-10-4-2-5-11-18)25(31)28-16-8-3-9-17-28/h2,4-7,10-13,23H,3,8-9,14-17H2,1H3 |
| InChIKey | RHLXSLVRZQTUJT-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |