C20H21FN2O5 — CID 55424509
[1-(3-fluoroanilino)-1-oxopropan-2-yl] 1-(furan-2-carbonyl)piperidine-4-carboxylate (PubChem CID 55424509) has the molecular formula C20H21FN2O5 and a molecular weight of 388.40 g/mol. Its IUPAC name is [1-(3-fluoroanilino)-1-oxopropan-2-yl] 1-(furan-2-carbonyl)piperidine-4-carboxylate.
| Compound Name | [1-(3-fluoroanilino)-1-oxopropan-2-yl] 1-(furan-2-carbonyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 55424509 |
| Molecular Formula | C20H21FN2O5 |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | [1-(3-fluoroanilino)-1-oxopropan-2-yl] 1-(furan-2-carbonyl)piperidine-4-carboxylate |
| SMILES | CC(OC(=O)C1CCN(C(=O)c2ccco2)CC1)C(=O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C20H21FN2O5/c1-13(18(24)22-16-5-2-4-15(21)12-16)28-20(26)14-7-9-23(10-8-14)19(25)17-6-3-11-27-17/h2-6,11-14H,7-10H2,1H3,(H,22,24) |
| InChIKey | QVLAJKLJHHCDRH-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.40 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |