C21H21N3O3 — CID 55424539
[1-[benzyl(methyl)amino]-1-oxopropan-2-yl] 3-phenyl-1H-pyrazole-5-carboxylate (PubChem CID 55424539) has the molecular formula C21H21N3O3 and a molecular weight of 363.42 g/mol. Its IUPAC name is [1-[benzyl(methyl)amino]-1-oxopropan-2-yl] 3-phenyl-1H-pyrazole-5-carboxylate.
| Compound Name | [1-[benzyl(methyl)amino]-1-oxopropan-2-yl] 3-phenyl-1H-pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 55424539 |
| Molecular Formula | C21H21N3O3 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | [1-[benzyl(methyl)amino]-1-oxopropan-2-yl] 3-phenyl-1H-pyrazole-5-carboxylate |
| SMILES | CC(OC(=O)c1cc(-c2ccccc2)n[nH]1)C(=O)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C21H21N3O3/c1-15(20(25)24(2)14-16-9-5-3-6-10-16)27-21(26)19-13-18(22-23-19)17-11-7-4-8-12-17/h3-13,15H,14H2,1-2H3,(H,22,23) |
| InChIKey | VNNGRDLGMLHVCQ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |