C23H25N3O4S — CID 55424640
[1-oxo-1-(thiophen-2-ylmethylamino)propan-2-yl] 13-oxo-6,7,8,9,10,11-hexahydroazocino[2,1-b]quinazoline-3-carboxylate (PubChem CID 55424640) has the molecular formula C23H25N3O4S and a molecular weight of 439.54 g/mol. Its IUPAC name is [1-oxo-1-(thiophen-2-ylmethylamino)propan-2-yl] 13-oxo-6,7,8,9,10,11-hexahydroazocino[2,1-b]quinazoline-3-carboxylate.
| Compound Name | [1-oxo-1-(thiophen-2-ylmethylamino)propan-2-yl] 13-oxo-6,7,8,9,10,11-hexahydroazocino[2,1-b]quinazoline-3-carboxylate |
|---|---|
| PubChem CID | 55424640 |
| Molecular Formula | C23H25N3O4S |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | [1-oxo-1-(thiophen-2-ylmethylamino)propan-2-yl] 13-oxo-6,7,8,9,10,11-hexahydroazocino[2,1-b]quinazoline-3-carboxylate |
| SMILES | CC(OC(=O)c1ccc2c(=O)n3c(nc2c1)CCCCCC3)C(=O)NCc1cccs1 |
| InChI | InChI=1S/C23H25N3O4S/c1-15(21(27)24-14-17-7-6-12-31-17)30-23(29)16-9-10-18-19(13-16)25-20-8-4-2-3-5-11-26(20)22(18)28/h6-7,9-10,12-13,15H,2-5,8,11,14H2,1H3,(H,24,27) |
| InChIKey | XXTRVUGQVOTKPW-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |