About [2-(trifluoromethyl)phenyl]methyl 2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetate
[2-(trifluoromethyl)phenyl]methyl 2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetate (PubChem CID 55425615) has the molecular formula C19H23F3N2O2
and a molecular weight of 368.40 g/mol. Its IUPAC name is [2-(trifluoromethyl)phenyl]methyl 2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetate.
Molecular Properties
| Compound Name | [2-(trifluoromethyl)phenyl]methyl 2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetate |
| PubChem CID | 55425615 |
| Molecular Formula | C19H23F3N2O2 |
| Molecular Weight | 368.40 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | [2-(trifluoromethyl)phenyl]methyl 2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetate |
| SMILES | Cc1nn(CC(C)C)c(C)c1CC(=O)OCc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C19H23F3N2O2/c1-12(2)10-24-14(4)16(13(3)23-24)9-18(25)26-11-15-7-5-6-8-17(15)19(20,21)22/h5-8,12H,9-11H2,1-4H3 |
| InChIKey | VJIJAMYQGUOYPW-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.40 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(trifluoromethyl)phenyl]methyl 2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(trifluoromethyl)phenyl]methyl 2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetate?
The IUPAC name of [2-(trifluoromethyl)phenyl]methyl 2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetate (CID 55425615) is [2-(trifluoromethyl)phenyl]methyl 2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetate.
What is the SMILES notation for [2-(trifluoromethyl)phenyl]methyl 2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetate?
The canonical SMILES for [2-(trifluoromethyl)phenyl]methyl 2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetate is Cc1nn(CC(C)C)c(C)c1CC(=O)OCc1ccccc1C(F)(F)F.
What is the InChIKey of [2-(trifluoromethyl)phenyl]methyl 2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetate?
The InChIKey is VJIJAMYQGUOYPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23F3N2O2/c1-12(2)10-24-14(4)16(13(3)23-24)9-18(25)26-11-15-7-5-6-8-17(15)19(20,21)22/h5-8,12H,9-11H2,1-4H3.
What are the key properties of [2-(trifluoromethyl)phenyl]methyl 2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetate?
[2-(trifluoromethyl)phenyl]methyl 2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetate has a molecular weight of 368.40 g/mol, XLogP of 4.46, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(trifluoromethyl)phenyl]methyl 2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetate is sourced from PubChem (CID 55425615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).