C25H34ClN5O3 — CID 55427316
2-[4-[(E)-3-[5-chloro-3-methyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]prop-2-enoyl]piperazin-1-yl]-N-(3-methoxypropyl)acetamide (PubChem CID 55427316) has the molecular formula C25H34ClN5O3 and a molecular weight of 488.03 g/mol. Its IUPAC name is 2-[4-[(E)-3-[5-chloro-3-methyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]prop-2-enoyl]piperazin-1-yl]-N-(3-methoxypropyl)acetamide.
| Compound Name | 2-[4-[(E)-3-[5-chloro-3-methyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]prop-2-enoyl]piperazin-1-yl]-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 55427316 |
| Molecular Formula | C25H34ClN5O3 |
| Molecular Weight | 488.03 g/mol |
| Exact Mass | 487.24 |
| IUPAC Name | 2-[4-[(E)-3-[5-chloro-3-methyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]prop-2-enoyl]piperazin-1-yl]-N-(3-methoxypropyl)acetamide |
| SMILES | COCCCNC(=O)CN1CCN(C(=O)/C=C/c2c(C)nn(Cc3ccc(C)cc3)c2Cl)CC1 |
| InChI | InChI=1S/C25H34ClN5O3/c1-19-5-7-21(8-6-19)17-31-25(26)22(20(2)28-31)9-10-24(33)30-14-12-29(13-15-30)18-23(32)27-11-4-16-34-3/h5-10H,4,11-18H2,1-3H3,(H,27,32)/b10-9+ |
| InChIKey | MXQYRIWUYMEQDX-MDZDMXLPSA-N |
| XLogP | 2.51 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.03 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|