C23H26N2O3S — CID 55428281
2-[1-(4-ethyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-4-methyl-1-oxopentan-2-yl]isoindole-1,3-dione (PubChem CID 55428281) has the molecular formula C23H26N2O3S and a molecular weight of 410.54 g/mol. Its IUPAC name is 2-[1-(4-ethyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-4-methyl-1-oxopentan-2-yl]isoindole-1,3-dione.
| Compound Name | 2-[1-(4-ethyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-4-methyl-1-oxopentan-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 55428281 |
| Molecular Formula | C23H26N2O3S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 2-[1-(4-ethyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-4-methyl-1-oxopentan-2-yl]isoindole-1,3-dione |
| SMILES | CCC1c2ccsc2CCN1C(=O)C(CC(C)C)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C23H26N2O3S/c1-4-18-17-10-12-29-20(17)9-11-24(18)23(28)19(13-14(2)3)25-21(26)15-7-5-6-8-16(15)22(25)27/h5-8,10,12,14,18-19H,4,9,11,13H2,1-3H3 |
| InChIKey | SHJCYKGRLVPCRC-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|