C22H30N4O3S2 — CID 55429028
N-(3-methoxypropyl)-2-[4-[4-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]benzoyl]piperazin-1-yl]acetamide (PubChem CID 55429028) has the molecular formula C22H30N4O3S2 and a molecular weight of 462.64 g/mol. Its IUPAC name is N-(3-methoxypropyl)-2-[4-[4-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]benzoyl]piperazin-1-yl]acetamide.
| Compound Name | N-(3-methoxypropyl)-2-[4-[4-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]benzoyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 55429028 |
| Molecular Formula | C22H30N4O3S2 |
| Molecular Weight | 462.64 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | N-(3-methoxypropyl)-2-[4-[4-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]benzoyl]piperazin-1-yl]acetamide |
| SMILES | COCCCNC(=O)CN1CCN(C(=O)c2ccc(CSc3nc(C)cs3)cc2)CC1 |
| InChI | InChI=1S/C22H30N4O3S2/c1-17-15-30-22(24-17)31-16-18-4-6-19(7-5-18)21(28)26-11-9-25(10-12-26)14-20(27)23-8-3-13-29-2/h4-7,15H,3,8-14,16H2,1-2H3,(H,23,27) |
| InChIKey | MVQYWIDRFCWNSC-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.64 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|