C24H23N3OS — CID 55429806
N-[(1-ethylbenzimidazol-2-yl)methyl]-2-phenyl-2-phenylsulfanylacetamide (PubChem CID 55429806) has the molecular formula C24H23N3OS and a molecular weight of 401.54 g/mol. Its IUPAC name is N-[(1-ethylbenzimidazol-2-yl)methyl]-2-phenyl-2-phenylsulfanylacetamide.
| Compound Name | N-[(1-ethylbenzimidazol-2-yl)methyl]-2-phenyl-2-phenylsulfanylacetamide |
|---|---|
| PubChem CID | 55429806 |
| Molecular Formula | C24H23N3OS |
| Molecular Weight | 401.54 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | N-[(1-ethylbenzimidazol-2-yl)methyl]-2-phenyl-2-phenylsulfanylacetamide |
| SMILES | CCn1c(CNC(=O)C(Sc2ccccc2)c2ccccc2)nc2ccccc21 |
| InChI | InChI=1S/C24H23N3OS/c1-2-27-21-16-10-9-15-20(21)26-22(27)17-25-24(28)23(18-11-5-3-6-12-18)29-19-13-7-4-8-14-19/h3-16,23H,2,17H2,1H3,(H,25,28) |
| InChIKey | AAJOBDFWBWPACC-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.54 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |