C20H25FN2O4 — CID 55431345
3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-[2-(2-fluorophenoxy)ethyl]-N-methylpropanamide (PubChem CID 55431345) has the molecular formula C20H25FN2O4 and a molecular weight of 376.43 g/mol. Its IUPAC name is 3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-[2-(2-fluorophenoxy)ethyl]-N-methylpropanamide.
| Compound Name | 3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-[2-(2-fluorophenoxy)ethyl]-N-methylpropanamide |
|---|---|
| PubChem CID | 55431345 |
| Molecular Formula | C20H25FN2O4 |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-[2-(2-fluorophenoxy)ethyl]-N-methylpropanamide |
| SMILES | CN(CCOc1ccccc1F)C(=O)CCN1C(=O)C2CCCCC2C1=O |
| InChI | InChI=1S/C20H25FN2O4/c1-22(12-13-27-17-9-5-4-8-16(17)21)18(24)10-11-23-19(25)14-6-2-3-7-15(14)20(23)26/h4-5,8-9,14-15H,2-3,6-7,10-13H2,1H3 |
| InChIKey | VFUWSXROVVQLFN-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|