C16H18ClNO4 — CID 55431674
methyl 5-[[2-(3-chlorophenoxy)ethyl-methylamino]methyl]furan-2-carboxylate (PubChem CID 55431674) has the molecular formula C16H18ClNO4 and a molecular weight of 323.78 g/mol. Its IUPAC name is methyl 5-[[2-(3-chlorophenoxy)ethyl-methylamino]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[2-(3-chlorophenoxy)ethyl-methylamino]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 55431674 |
| Molecular Formula | C16H18ClNO4 |
| Molecular Weight | 323.78 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | methyl 5-[[2-(3-chlorophenoxy)ethyl-methylamino]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CN(C)CCOc2cccc(Cl)c2)o1 |
| InChI | InChI=1S/C16H18ClNO4/c1-18(8-9-21-13-5-3-4-12(17)10-13)11-14-6-7-15(22-14)16(19)20-2/h3-7,10H,8-9,11H2,1-2H3 |
| InChIKey | GWLHRMAUSPSNQZ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.78 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |