C22H26N4O5S2 — CID 55431748
3-[1-(4-pyrrolidin-1-ylsulfonylphenyl)sulfonylpiperidin-4-yl]-1H-benzimidazol-2-one (PubChem CID 55431748) has the molecular formula C22H26N4O5S2 and a molecular weight of 490.61 g/mol. Its IUPAC name is 3-[1-(4-pyrrolidin-1-ylsulfonylphenyl)sulfonylpiperidin-4-yl]-1H-benzimidazol-2-one.
| Compound Name | 3-[1-(4-pyrrolidin-1-ylsulfonylphenyl)sulfonylpiperidin-4-yl]-1H-benzimidazol-2-one |
|---|---|
| PubChem CID | 55431748 |
| Molecular Formula | C22H26N4O5S2 |
| Molecular Weight | 490.61 g/mol |
| Exact Mass | 490.13 |
| IUPAC Name | 3-[1-(4-pyrrolidin-1-ylsulfonylphenyl)sulfonylpiperidin-4-yl]-1H-benzimidazol-2-one |
| SMILES | O=c1[nH]c2ccccc2n1C1CCN(S(=O)(=O)c2ccc(S(=O)(=O)N3CCCC3)cc2)CC1 |
| InChI | InChI=1S/C22H26N4O5S2/c27-22-23-20-5-1-2-6-21(20)26(22)17-11-15-25(16-12-17)33(30,31)19-9-7-18(8-10-19)32(28,29)24-13-3-4-14-24/h1-2,5-10,17H,3-4,11-16H2,(H,23,27) |
| InChIKey | JSYQPXODKUCZMS-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 112.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.61 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |