C15H13F2N5O4S2 — CID 55431866
6-[4-(2,5-difluorophenyl)sulfonylpiperazin-1-yl]-5-nitroimidazo[2,1-b][1,3]thiazole (PubChem CID 55431866) has the molecular formula C15H13F2N5O4S2 and a molecular weight of 429.43 g/mol. Its IUPAC name is 6-[4-(2,5-difluorophenyl)sulfonylpiperazin-1-yl]-5-nitroimidazo[2,1-b][1,3]thiazole.
| Compound Name | 6-[4-(2,5-difluorophenyl)sulfonylpiperazin-1-yl]-5-nitroimidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 55431866 |
| Molecular Formula | C15H13F2N5O4S2 |
| Molecular Weight | 429.43 g/mol |
| Exact Mass | 429.04 |
| IUPAC Name | 6-[4-(2,5-difluorophenyl)sulfonylpiperazin-1-yl]-5-nitroimidazo[2,1-b][1,3]thiazole |
| SMILES | O=[N+]([O-])c1c(N2CCN(S(=O)(=O)c3cc(F)ccc3F)CC2)nc2sccn12 |
| InChI | InChI=1S/C15H13F2N5O4S2/c16-10-1-2-11(17)12(9-10)28(25,26)20-5-3-19(4-6-20)13-14(22(23)24)21-7-8-27-15(21)18-13/h1-2,7-9H,3-6H2 |
| InChIKey | DXQOWYFNBPBPBF-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.43 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|