About 4-fluoro-N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-1-benzothiophene-2-carboxamide
4-fluoro-N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-1-benzothiophene-2-carboxamide (PubChem CID 55433378) has the molecular formula C18H13F2NOS2
and a molecular weight of 361.44 g/mol. Its IUPAC name is 4-fluoro-N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-1-benzothiophene-2-carboxamide.
Molecular Properties
| Compound Name | 4-fluoro-N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-1-benzothiophene-2-carboxamide |
| PubChem CID | 55433378 |
| Molecular Formula | C18H13F2NOS2 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | 4-fluoro-N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NC1CCSc2ccc(F)cc21)c1cc2c(F)cccc2s1 |
| InChI | InChI=1S/C18H13F2NOS2/c19-10-4-5-15-12(8-10)14(6-7-23-15)21-18(22)17-9-11-13(20)2-1-3-16(11)24-17/h1-5,8-9,14H,6-7H2,(H,21,22) |
| InChIKey | JBSUOUXHAUMTJF-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-fluoro-N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-1-benzothiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-1-benzothiophene-2-carboxamide?
The IUPAC name of 4-fluoro-N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-1-benzothiophene-2-carboxamide (CID 55433378) is 4-fluoro-N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-1-benzothiophene-2-carboxamide.
What is the SMILES notation for 4-fluoro-N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-1-benzothiophene-2-carboxamide?
The canonical SMILES for 4-fluoro-N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-1-benzothiophene-2-carboxamide is O=C(NC1CCSc2ccc(F)cc21)c1cc2c(F)cccc2s1.
What is the InChIKey of 4-fluoro-N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-1-benzothiophene-2-carboxamide?
The InChIKey is JBSUOUXHAUMTJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13F2NOS2/c19-10-4-5-15-12(8-10)14(6-7-23-15)21-18(22)17-9-11-13(20)2-1-3-16(11)24-17/h1-5,8-9,14H,6-7H2,(H,21,22).
What are the key properties of 4-fluoro-N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-1-benzothiophene-2-carboxamide?
4-fluoro-N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-1-benzothiophene-2-carboxamide has a molecular weight of 361.44 g/mol, XLogP of 5.15, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-1-benzothiophene-2-carboxamide is sourced from PubChem (CID 55433378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).