C19H21FN4O5S2 — CID 55435097
(2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazin-9-yl)-[4-(4-fluorophenyl)sulfonyl-1,4-diazepan-1-yl]methanone (PubChem CID 55435097) has the molecular formula C19H21FN4O5S2 and a molecular weight of 468.53 g/mol. Its IUPAC name is (2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazin-9-yl)-[4-(4-fluorophenyl)sulfonyl-1,4-diazepan-1-yl]methanone.
| Compound Name | (2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazin-9-yl)-[4-(4-fluorophenyl)sulfonyl-1,4-diazepan-1-yl]methanone |
|---|---|
| PubChem CID | 55435097 |
| Molecular Formula | C19H21FN4O5S2 |
| Molecular Weight | 468.53 g/mol |
| Exact Mass | 468.09 |
| IUPAC Name | (2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazin-9-yl)-[4-(4-fluorophenyl)sulfonyl-1,4-diazepan-1-yl]methanone |
| SMILES | O=C(C1=CC=CN2CCS(=O)(=O)N=C12)N1CCCN(S(=O)(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C19H21FN4O5S2/c20-15-4-6-16(7-5-15)31(28,29)24-10-2-9-23(11-12-24)19(25)17-3-1-8-22-13-14-30(26,27)21-18(17)22/h1,3-8H,2,9-14H2 |
| InChIKey | UJBJQNAGKIOLMZ-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 107.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.53 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |