C23H40O3Si — CID 554352
[7-[3-[tert-butyl(dimethyl)silyl]oxyprop-1-en-2-yl]-1,4a-dimethyl-3,4,5,6,7,8-hexahydro-2H-naphthalen-2-yl] acetate (PubChem CID 554352) has the molecular formula C23H40O3Si and a molecular weight of 392.66 g/mol. Its IUPAC name is [7-[3-[tert-butyl(dimethyl)silyl]oxyprop-1-en-2-yl]-1,4a-dimethyl-3,4,5,6,7,8-hexahydro-2H-naphthalen-2-yl] acetate.
| Compound Name | [7-[3-[tert-butyl(dimethyl)silyl]oxyprop-1-en-2-yl]-1,4a-dimethyl-3,4,5,6,7,8-hexahydro-2H-naphthalen-2-yl] acetate |
|---|---|
| PubChem CID | 554352 |
| Molecular Formula | C23H40O3Si |
| Molecular Weight | 392.66 g/mol |
| Exact Mass | 392.27 |
| IUPAC Name | [7-[3-[tert-butyl(dimethyl)silyl]oxyprop-1-en-2-yl]-1,4a-dimethyl-3,4,5,6,7,8-hexahydro-2H-naphthalen-2-yl] acetate |
| SMILES | C=C(CO[Si](C)(C)C(C)(C)C)C1CCC2(C)CCC(OC(C)=O)C(C)=C2C1 |
| InChI | InChI=1S/C23H40O3Si/c1-16(15-25-27(8,9)22(4,5)6)19-10-12-23(7)13-11-21(26-18(3)24)17(2)20(23)14-19/h19,21H,1,10-15H2,2-9H3 |
| InChIKey | PJGOGQFAOBZHCV-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.66 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|