About 1-(2,2-dimethoxyethyl)-1-methylguanidine
1-(2,2-dimethoxyethyl)-1-methylguanidine (PubChem CID 554358) has the molecular formula C6H15N3O2
and a molecular weight of 161.20 g/mol. Its IUPAC name is 1-(2,2-dimethoxyethyl)-1-methylguanidine.
Molecular Properties
| Compound Name | 1-(2,2-dimethoxyethyl)-1-methylguanidine |
| PubChem CID | 554358 |
| Molecular Formula | C6H15N3O2 |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | 1-(2,2-dimethoxyethyl)-1-methylguanidine |
| SMILES | [H]/N=C(\N)N(C)CC(OC)OC |
| InChI | InChI=1S/C6H15N3O2/c1-9(6(7)8)4-5(10-2)11-3/h5H,4H2,1-3H3,(H3,7,8) |
| InChIKey | DKNIACQKFMPIMH-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 71.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,2-dimethoxyethyl)-1-methylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2-dimethoxyethyl)-1-methylguanidine?
The IUPAC name of 1-(2,2-dimethoxyethyl)-1-methylguanidine (CID 554358) is 1-(2,2-dimethoxyethyl)-1-methylguanidine.
What is the SMILES notation for 1-(2,2-dimethoxyethyl)-1-methylguanidine?
The canonical SMILES for 1-(2,2-dimethoxyethyl)-1-methylguanidine is [H]/N=C(\N)N(C)CC(OC)OC.
What is the InChIKey of 1-(2,2-dimethoxyethyl)-1-methylguanidine?
The InChIKey is DKNIACQKFMPIMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N3O2/c1-9(6(7)8)4-5(10-2)11-3/h5H,4H2,1-3H3,(H3,7,8).
What are the key properties of 1-(2,2-dimethoxyethyl)-1-methylguanidine?
1-(2,2-dimethoxyethyl)-1-methylguanidine has a molecular weight of 161.20 g/mol, XLogP of -0.57, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-dimethoxyethyl)-1-methylguanidine is sourced from PubChem (CID 554358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).