C15H23N3O4S — CID 55436106
3-[3-oxo-3-[4-(oxolane-2-carbonyl)piperazin-1-yl]propyl]-1,3-thiazolidin-2-one (PubChem CID 55436106) has the molecular formula C15H23N3O4S and a molecular weight of 341.43 g/mol. Its IUPAC name is 3-[3-oxo-3-[4-(oxolane-2-carbonyl)piperazin-1-yl]propyl]-1,3-thiazolidin-2-one.
| Compound Name | 3-[3-oxo-3-[4-(oxolane-2-carbonyl)piperazin-1-yl]propyl]-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 55436106 |
| Molecular Formula | C15H23N3O4S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 3-[3-oxo-3-[4-(oxolane-2-carbonyl)piperazin-1-yl]propyl]-1,3-thiazolidin-2-one |
| SMILES | O=C(CCN1CCSC1=O)N1CCN(C(=O)C2CCCO2)CC1 |
| InChI | InChI=1S/C15H23N3O4S/c19-13(3-4-18-9-11-23-15(18)21)16-5-7-17(8-6-16)14(20)12-2-1-10-22-12/h12H,1-11H2 |
| InChIKey | GFHMBHAHXWWOAG-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|