C20H23Cl2N3O3S — CID 55437561
1-[4-(2,6-dichlorophenyl)sulfonylpiperazin-1-yl]-2-(N-ethylanilino)ethanone (PubChem CID 55437561) has the molecular formula C20H23Cl2N3O3S and a molecular weight of 456.40 g/mol. Its IUPAC name is 1-[4-(2,6-dichlorophenyl)sulfonylpiperazin-1-yl]-2-(N-ethylanilino)ethanone.
| Compound Name | 1-[4-(2,6-dichlorophenyl)sulfonylpiperazin-1-yl]-2-(N-ethylanilino)ethanone |
|---|---|
| PubChem CID | 55437561 |
| Molecular Formula | C20H23Cl2N3O3S |
| Molecular Weight | 456.40 g/mol |
| Exact Mass | 455.08 |
| IUPAC Name | 1-[4-(2,6-dichlorophenyl)sulfonylpiperazin-1-yl]-2-(N-ethylanilino)ethanone |
| SMILES | CCN(CC(=O)N1CCN(S(=O)(=O)c2c(Cl)cccc2Cl)CC1)c1ccccc1 |
| InChI | InChI=1S/C20H23Cl2N3O3S/c1-2-23(16-7-4-3-5-8-16)15-19(26)24-11-13-25(14-12-24)29(27,28)20-17(21)9-6-10-18(20)22/h3-10H,2,11-15H2,1H3 |
| InChIKey | IHFIVIUREJEPGZ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.40 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |