C13H20N2O3 — CID 55437645
2-(2-methoxyanilino)-N-(1-methoxypropan-2-yl)acetamide (PubChem CID 55437645) has the molecular formula C13H20N2O3 and a molecular weight of 252.31 g/mol. Its IUPAC name is 2-(2-methoxyanilino)-N-(1-methoxypropan-2-yl)acetamide.
| Compound Name | 2-(2-methoxyanilino)-N-(1-methoxypropan-2-yl)acetamide |
|---|---|
| PubChem CID | 55437645 |
| Molecular Formula | C13H20N2O3 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | 2-(2-methoxyanilino)-N-(1-methoxypropan-2-yl)acetamide |
| SMILES | COCC(C)NC(=O)CNc1ccccc1OC |
| InChI | InChI=1S/C13H20N2O3/c1-10(9-17-2)15-13(16)8-14-11-6-4-5-7-12(11)18-3/h4-7,10,14H,8-9H2,1-3H3,(H,15,16) |
| InChIKey | ZIRZQUPUXVVPIT-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |