C8H16O3 — CID 554386
1,1-dimethoxy-3-methylpentan-2-one (PubChem CID 554386) has the molecular formula C8H16O3 and a molecular weight of 160.21 g/mol. Its IUPAC name is 1,1-dimethoxy-3-methylpentan-2-one.
| Compound Name | 1,1-dimethoxy-3-methylpentan-2-one |
|---|---|
| PubChem CID | 554386 |
| Molecular Formula | C8H16O3 |
| Molecular Weight | 160.21 g/mol |
| Exact Mass | 160.11 |
| IUPAC Name | 1,1-dimethoxy-3-methylpentan-2-one |
| SMILES | CCC(C)C(=O)C(OC)OC |
| InChI | InChI=1S/C8H16O3/c1-5-6(2)7(9)8(10-3)11-4/h6,8H,5H2,1-4H3 |
| InChIKey | SLJQWQAYIRMBLJ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.21 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|