C22H27N3OS — CID 55439114
N-(3-methyl-1-phenylbutyl)-2-[2-(methylsulfanylmethyl)benzimidazol-1-yl]acetamide (PubChem CID 55439114) has the molecular formula C22H27N3OS and a molecular weight of 381.55 g/mol. Its IUPAC name is N-(3-methyl-1-phenylbutyl)-2-[2-(methylsulfanylmethyl)benzimidazol-1-yl]acetamide.
| Compound Name | N-(3-methyl-1-phenylbutyl)-2-[2-(methylsulfanylmethyl)benzimidazol-1-yl]acetamide |
|---|---|
| PubChem CID | 55439114 |
| Molecular Formula | C22H27N3OS |
| Molecular Weight | 381.55 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | N-(3-methyl-1-phenylbutyl)-2-[2-(methylsulfanylmethyl)benzimidazol-1-yl]acetamide |
| SMILES | CSCc1nc2ccccc2n1CC(=O)NC(CC(C)C)c1ccccc1 |
| InChI | InChI=1S/C22H27N3OS/c1-16(2)13-19(17-9-5-4-6-10-17)24-22(26)14-25-20-12-8-7-11-18(20)23-21(25)15-27-3/h4-12,16,19H,13-15H2,1-3H3,(H,24,26) |
| InChIKey | SEPUPEADFLDHFB-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.55 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |