About 1,1,2,2-tetramethoxyethane
1,1,2,2-tetramethoxyethane (PubChem CID 554434) has the molecular formula C6H14O4
and a molecular weight of 150.17 g/mol. Its IUPAC name is 1,1,2,2-tetramethoxyethane.
Molecular Properties
| Compound Name | 1,1,2,2-tetramethoxyethane |
| PubChem CID | 554434 |
| Molecular Formula | C6H14O4 |
| Molecular Weight | 150.17 g/mol |
| Exact Mass | 150.09 |
| IUPAC Name | 1,1,2,2-tetramethoxyethane |
| SMILES | COC(OC)C(OC)OC |
| InChI | InChI=1S/C6H14O4/c1-7-5(8-2)6(9-3)10-4/h5-6H,1-4H3 |
| InChIKey | IVXUXKRSTIMKOE-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.17 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1,1,2,2-tetramethoxyethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1,2,2-tetramethoxyethane?
The IUPAC name of 1,1,2,2-tetramethoxyethane (CID 554434) is 1,1,2,2-tetramethoxyethane.
What is the SMILES notation for 1,1,2,2-tetramethoxyethane?
The canonical SMILES for 1,1,2,2-tetramethoxyethane is COC(OC)C(OC)OC.
What is the InChIKey of 1,1,2,2-tetramethoxyethane?
The InChIKey is IVXUXKRSTIMKOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O4/c1-7-5(8-2)6(9-3)10-4/h5-6H,1-4H3.
What are the key properties of 1,1,2,2-tetramethoxyethane?
1,1,2,2-tetramethoxyethane has a molecular weight of 150.17 g/mol, XLogP of 0.22, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1,2,2-tetramethoxyethane is sourced from PubChem (CID 554434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).