C21H23N3O5 — CID 55443494
[2-oxo-2-[4-(phenylcarbamoyl)piperazin-1-yl]ethyl] 2-hydroxy-3-methylbenzoate (PubChem CID 55443494) has the molecular formula C21H23N3O5 and a molecular weight of 397.43 g/mol. Its IUPAC name is [2-oxo-2-[4-(phenylcarbamoyl)piperazin-1-yl]ethyl] 2-hydroxy-3-methylbenzoate.
| Compound Name | [2-oxo-2-[4-(phenylcarbamoyl)piperazin-1-yl]ethyl] 2-hydroxy-3-methylbenzoate |
|---|---|
| PubChem CID | 55443494 |
| Molecular Formula | C21H23N3O5 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | [2-oxo-2-[4-(phenylcarbamoyl)piperazin-1-yl]ethyl] 2-hydroxy-3-methylbenzoate |
| SMILES | Cc1cccc(C(=O)OCC(=O)N2CCN(C(=O)Nc3ccccc3)CC2)c1O |
| InChI | InChI=1S/C21H23N3O5/c1-15-6-5-9-17(19(15)26)20(27)29-14-18(25)23-10-12-24(13-11-23)21(28)22-16-7-3-2-4-8-16/h2-9,26H,10-14H2,1H3,(H,22,28) |
| InChIKey | JXUSLNHWNQKAPA-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |